C21H28N2O6 — CID 9067659
methyl 4-[[2-[5-(cyclohexylamino)-5-oxopentanoyl]oxyacetyl]amino]benzoate (PubChem CID 9067659) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is methyl 4-[[2-[5-(cyclohexylamino)-5-oxopentanoyl]oxyacetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[5-(cyclohexylamino)-5-oxopentanoyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 9067659 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | methyl 4-[[2-[5-(cyclohexylamino)-5-oxopentanoyl]oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)COC(=O)CCCC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C21H28N2O6/c1-28-21(27)15-10-12-17(13-11-15)23-19(25)14-29-20(26)9-5-8-18(24)22-16-6-3-2-4-7-16/h10-13,16H,2-9,14H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | ZQFXTCNCPVYECI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |