C14H20Cl3NO3 — CID 2201708
2,3,3-trichloroprop-2-enyl 5-(cyclohexylamino)-5-oxopentanoate (PubChem CID 2201708) has the molecular formula C14H20Cl3NO3 and a molecular weight of 356.68 g/mol. Its IUPAC name is 2,3,3-trichloroprop-2-enyl 5-(cyclohexylamino)-5-oxopentanoate.
| Compound Name | 2,3,3-trichloroprop-2-enyl 5-(cyclohexylamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 2201708 |
| Molecular Formula | C14H20Cl3NO3 |
| Molecular Weight | 356.68 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 2,3,3-trichloroprop-2-enyl 5-(cyclohexylamino)-5-oxopentanoate |
| SMILES | O=C(CCCC(=O)OCC(Cl)=C(Cl)Cl)NC1CCCCC1 |
| InChI | InChI=1S/C14H20Cl3NO3/c15-11(14(16)17)9-21-13(20)8-4-7-12(19)18-10-5-2-1-3-6-10/h10H,1-9H2,(H,18,19) |
| InChIKey | ZEEHYALNZRIHKD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.68 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |