About N-cycloheptylnonanamide
N-cycloheptylnonanamide (PubChem CID 5045141) has the molecular formula C16H31NO
and a molecular weight of 253.43 g/mol. Its IUPAC name is N-cycloheptylnonanamide.
Molecular Properties
| Compound Name | N-cycloheptylnonanamide |
| PubChem CID | 5045141 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | N-cycloheptylnonanamide |
| SMILES | CCCCCCCCC(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C16H31NO/c1-2-3-4-5-6-11-14-16(18)17-15-12-9-7-8-10-13-15/h15H,2-14H2,1H3,(H,17,18) |
| InChIKey | GFSBBXUHEJTUHE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-cycloheptylnonanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptylnonanamide?
The IUPAC name of N-cycloheptylnonanamide (CID 5045141) is N-cycloheptylnonanamide.
What is the SMILES notation for N-cycloheptylnonanamide?
The canonical SMILES for N-cycloheptylnonanamide is CCCCCCCCC(=O)NC1CCCCCC1.
What is the InChIKey of N-cycloheptylnonanamide?
The InChIKey is GFSBBXUHEJTUHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO/c1-2-3-4-5-6-11-14-16(18)17-15-12-9-7-8-10-13-15/h15H,2-14H2,1H3,(H,17,18).
What are the key properties of N-cycloheptylnonanamide?
N-cycloheptylnonanamide has a molecular weight of 253.43 g/mol, XLogP of 4.58, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptylnonanamide is sourced from PubChem (CID 5045141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).