About N-cyclooctylbutanamide
N-cyclooctylbutanamide (PubChem CID 4614062) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is N-cyclooctylbutanamide.
Molecular Properties
| Compound Name | N-cyclooctylbutanamide |
| PubChem CID | 4614062 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | N-cyclooctylbutanamide |
| SMILES | CCCC(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C12H23NO/c1-2-8-12(14)13-11-9-6-4-3-5-7-10-11/h11H,2-10H2,1H3,(H,13,14) |
| InChIKey | NEOYBSAUXDUYGS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclooctylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclooctylbutanamide?
The IUPAC name of N-cyclooctylbutanamide (CID 4614062) is N-cyclooctylbutanamide.
What is the SMILES notation for N-cyclooctylbutanamide?
The canonical SMILES for N-cyclooctylbutanamide is CCCC(=O)NC1CCCCCCC1.
What is the InChIKey of N-cyclooctylbutanamide?
The InChIKey is NEOYBSAUXDUYGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-2-8-12(14)13-11-9-6-4-3-5-7-10-11/h11H,2-10H2,1H3,(H,13,14).
What are the key properties of N-cyclooctylbutanamide?
N-cyclooctylbutanamide has a molecular weight of 197.32 g/mol, XLogP of 3.02, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclooctylbutanamide is sourced from PubChem (CID 4614062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).