About N-cyclodecylpropanamide
N-cyclodecylpropanamide (PubChem CID 122483649) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is N-cyclodecylpropanamide.
Molecular Properties
| Compound Name | N-cyclodecylpropanamide |
| PubChem CID | 122483649 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | N-cyclodecylpropanamide |
| SMILES | CCC(=O)NC1CCCCCCCCC1 |
| InChI | InChI=1S/C13H25NO/c1-2-13(15)14-12-10-8-6-4-3-5-7-9-11-12/h12H,2-11H2,1H3,(H,14,15) |
| InChIKey | ZYPSOTIGWSIUFE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclodecylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclodecylpropanamide?
The IUPAC name of N-cyclodecylpropanamide (CID 122483649) is N-cyclodecylpropanamide.
What is the SMILES notation for N-cyclodecylpropanamide?
The canonical SMILES for N-cyclodecylpropanamide is CCC(=O)NC1CCCCCCCCC1.
What is the InChIKey of N-cyclodecylpropanamide?
The InChIKey is ZYPSOTIGWSIUFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO/c1-2-13(15)14-12-10-8-6-4-3-5-7-9-11-12/h12H,2-11H2,1H3,(H,14,15).
What are the key properties of N-cyclodecylpropanamide?
N-cyclodecylpropanamide has a molecular weight of 211.35 g/mol, XLogP of 3.41, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclodecylpropanamide is sourced from PubChem (CID 122483649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).