About potassium;N-cyclohexylpropanamide;hydride
potassium;N-cyclohexylpropanamide;hydride (PubChem CID 173020790) has the molecular formula C9H18KNO
and a molecular weight of 195.35 g/mol. Its IUPAC name is potassium;N-cyclohexylpropanamide;hydride.
Molecular Properties
| Compound Name | potassium;N-cyclohexylpropanamide;hydride |
| PubChem CID | 173020790 |
| Molecular Formula | C9H18KNO |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | potassium;N-cyclohexylpropanamide;hydride |
| SMILES | CCC(=O)NC1CCCCC1.[H-].[K+] |
| InChI | InChI=1S/C9H17NO.K.H/c1-2-9(11)10-8-6-4-3-5-7-8;;/h8H,2-7H2,1H3,(H,10,11);;/q;+1;-1 |
| InChIKey | UJJGBQKJQCWWCP-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze potassium;N-cyclohexylpropanamide;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;N-cyclohexylpropanamide;hydride?
The IUPAC name of potassium;N-cyclohexylpropanamide;hydride (CID 173020790) is potassium;N-cyclohexylpropanamide;hydride.
What is the SMILES notation for potassium;N-cyclohexylpropanamide;hydride?
The canonical SMILES for potassium;N-cyclohexylpropanamide;hydride is CCC(=O)NC1CCCCC1.[H-].[K+].
What is the InChIKey of potassium;N-cyclohexylpropanamide;hydride?
The InChIKey is UJJGBQKJQCWWCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO.K.H/c1-2-9(11)10-8-6-4-3-5-7-8;;/h8H,2-7H2,1H3,(H,10,11);;/q;+1;-1.
What are the key properties of potassium;N-cyclohexylpropanamide;hydride?
potassium;N-cyclohexylpropanamide;hydride has a molecular weight of 195.35 g/mol, XLogP of -1.04, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;N-cyclohexylpropanamide;hydride is sourced from PubChem (CID 173020790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).