C15H29N3O3Y5-2 — CID 158984107
N-cyclohexylpropanamide;bis(N-methylacetamide);pentakis(yttrium) (PubChem CID 158984107) has the molecular formula C15H29N3O3Y5-2 and a molecular weight of 743.94 g/mol. Its IUPAC name is N-cyclohexylpropanamide;bis(N-methylacetamide);pentakis(yttrium).
| Compound Name | N-cyclohexylpropanamide;bis(N-methylacetamide);pentakis(yttrium) |
|---|---|
| PubChem CID | 158984107 |
| Molecular Formula | C15H29N3O3Y5-2 |
| Molecular Weight | 743.94 g/mol |
| Exact Mass | 743.75 |
| IUPAC Name | N-cyclohexylpropanamide;bis(N-methylacetamide);pentakis(yttrium) |
| SMILES | CCC(=O)NC1CCCCC1.[CH2-]C(=O)NC.[CH2-]C(=O)NC.[Y].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C9H17NO.2C3H6NO.5Y/c1-2-9(11)10-8-6-4-3-5-7-8;2*1-3(5)4-2;;;;;/h8H,2-7H2,1H3,(H,10,11);2*1H2,2H3,(H,4,5);;;;;/q;2*-1;;;;; |
| InChIKey | YRIGNCFGVPPWKZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.94 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|