C32H42N4O4 — CID 43878588
N,N'-bis[4-(cyclohexylcarbamoyl)phenyl]hexanediamide (PubChem CID 43878588) has the molecular formula C32H42N4O4 and a molecular weight of 546.71 g/mol. Its IUPAC name is N,N'-bis[4-(cyclohexylcarbamoyl)phenyl]hexanediamide.
| Compound Name | N,N'-bis[4-(cyclohexylcarbamoyl)phenyl]hexanediamide |
|---|---|
| PubChem CID | 43878588 |
| Molecular Formula | C32H42N4O4 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | N,N'-bis[4-(cyclohexylcarbamoyl)phenyl]hexanediamide |
| SMILES | O=C(CCCCC(=O)Nc1ccc(C(=O)NC2CCCCC2)cc1)Nc1ccc(C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C32H42N4O4/c37-29(33-27-19-15-23(16-20-27)31(39)35-25-9-3-1-4-10-25)13-7-8-14-30(38)34-28-21-17-24(18-22-28)32(40)36-26-11-5-2-6-12-26/h15-22,25-26H,1-14H2,(H,33,37)(H,34,38)(H,35,39)(H,36,40) |
| InChIKey | BWKTZPRMEPAKGN-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|