C20H24N2O4S2 — CID 22427359
N-cyclohexyl-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide (PubChem CID 22427359) has the molecular formula C20H24N2O4S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-cyclohexyl-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide.
| Compound Name | N-cyclohexyl-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 22427359 |
| Molecular Formula | C20H24N2O4S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-cyclohexyl-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide |
| SMILES | O=C(CCS(=O)(=O)c1cccs1)Nc1ccc(C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C20H24N2O4S2/c23-18(12-14-28(25,26)19-7-4-13-27-19)21-17-10-8-15(9-11-17)20(24)22-16-5-2-1-3-6-16/h4,7-11,13,16H,1-3,5-6,12,14H2,(H,21,23)(H,22,24) |
| InChIKey | LSJGDQRLRBNEKG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |