C22H22N2O4S2 — CID 46246296
N-(2-ethylphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide (PubChem CID 46246296) has the molecular formula C22H22N2O4S2 and a molecular weight of 442.56 g/mol. Its IUPAC name is N-(2-ethylphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide.
| Compound Name | N-(2-ethylphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 46246296 |
| Molecular Formula | C22H22N2O4S2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | N-(2-ethylphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide |
| SMILES | CCc1ccccc1NC(=O)c1ccc(NC(=O)CCS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C22H22N2O4S2/c1-2-16-6-3-4-7-19(16)24-22(26)17-9-11-18(12-10-17)23-20(25)13-15-30(27,28)21-8-5-14-29-21/h3-12,14H,2,13,15H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | AKIQZKWNORFJJN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |