C13H14N2O3S2 — CID 43443981
N-(2-aminophenyl)-3-thiophen-2-ylsulfonylpropanamide (PubChem CID 43443981) has the molecular formula C13H14N2O3S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-thiophen-2-ylsulfonylpropanamide.
| Compound Name | N-(2-aminophenyl)-3-thiophen-2-ylsulfonylpropanamide |
|---|---|
| PubChem CID | 43443981 |
| Molecular Formula | C13H14N2O3S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | N-(2-aminophenyl)-3-thiophen-2-ylsulfonylpropanamide |
| SMILES | Nc1ccccc1NC(=O)CCS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H14N2O3S2/c14-10-4-1-2-5-11(10)15-12(16)7-9-20(17,18)13-6-3-8-19-13/h1-6,8H,7,9,14H2,(H,15,16) |
| InChIKey | OGTLXMZAGPOLHG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|