C16H19N5O2 — CID 102158017
2-[[2-(2-aminoanilino)-2-oxoethyl]amino]-N-(2-aminophenyl)acetamide (PubChem CID 102158017) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-[[2-(2-aminoanilino)-2-oxoethyl]amino]-N-(2-aminophenyl)acetamide.
| Compound Name | 2-[[2-(2-aminoanilino)-2-oxoethyl]amino]-N-(2-aminophenyl)acetamide |
|---|---|
| PubChem CID | 102158017 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2-[[2-(2-aminoanilino)-2-oxoethyl]amino]-N-(2-aminophenyl)acetamide |
| SMILES | Nc1ccccc1NC(=O)CNCC(=O)Nc1ccccc1N |
| InChI | InChI=1S/C16H19N5O2/c17-11-5-1-3-7-13(11)20-15(22)9-19-10-16(23)21-14-8-4-2-6-12(14)18/h1-8,19H,9-10,17-18H2,(H,20,22)(H,21,23) |
| InChIKey | JVBGILQPMQHQIG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|