C17H19N3O — CID 62206919
N-(2-aminophenyl)-3-(1,3-dihydroisoindol-2-yl)propanamide (PubChem CID 62206919) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-(1,3-dihydroisoindol-2-yl)propanamide.
| Compound Name | N-(2-aminophenyl)-3-(1,3-dihydroisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 62206919 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-(2-aminophenyl)-3-(1,3-dihydroisoindol-2-yl)propanamide |
| SMILES | Nc1ccccc1NC(=O)CCN1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H19N3O/c18-15-7-3-4-8-16(15)19-17(21)9-10-20-11-13-5-1-2-6-14(13)12-20/h1-8H,9-12,18H2,(H,19,21) |
| InChIKey | FVNWOOAGFGUXDO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|