C19H25Cl2N3O — CID 119422356
N-(2-aminophenyl)-3-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)propanamide;dihydrochloride (PubChem CID 119422356) has the molecular formula C19H25Cl2N3O and a molecular weight of 382.34 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)propanamide;dihydrochloride.
| Compound Name | N-(2-aminophenyl)-3-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119422356 |
| Molecular Formula | C19H25Cl2N3O |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N-(2-aminophenyl)-3-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)propanamide;dihydrochloride |
| SMILES | CC1CCc2ccccc2N1CCC(=O)Nc1ccccc1N.Cl.Cl |
| InChI | InChI=1S/C19H23N3O.2ClH/c1-14-10-11-15-6-2-5-9-18(15)22(14)13-12-19(23)21-17-8-4-3-7-16(17)20;;/h2-9,14H,10-13,20H2,1H3,(H,21,23);2*1H |
| InChIKey | WKXHADNVZHGQAV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|