C13H14N4O3 — CID 16790022
N-(2-aminophenyl)-3-(3,6-dioxo-1H-pyridazin-2-yl)propanamide (PubChem CID 16790022) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-(3,6-dioxo-1H-pyridazin-2-yl)propanamide.
| Compound Name | N-(2-aminophenyl)-3-(3,6-dioxo-1H-pyridazin-2-yl)propanamide |
|---|---|
| PubChem CID | 16790022 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | N-(2-aminophenyl)-3-(3,6-dioxo-1H-pyridazin-2-yl)propanamide |
| SMILES | Nc1ccccc1NC(=O)CCn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C13H14N4O3/c14-9-3-1-2-4-10(9)15-11(18)7-8-17-13(20)6-5-12(19)16-17/h1-6H,7-8,14H2,(H,15,18)(H,16,19) |
| InChIKey | PQJWSZBHFFZKGB-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|