C20H17N3O5 — CID 30855514
3-(3,6-dioxo-1H-pyridazin-2-yl)-N-(2-methoxydibenzofuran-3-yl)propanamide (PubChem CID 30855514) has the molecular formula C20H17N3O5 and a molecular weight of 379.37 g/mol. Its IUPAC name is 3-(3,6-dioxo-1H-pyridazin-2-yl)-N-(2-methoxydibenzofuran-3-yl)propanamide.
| Compound Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)-N-(2-methoxydibenzofuran-3-yl)propanamide |
|---|---|
| PubChem CID | 30855514 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)-N-(2-methoxydibenzofuran-3-yl)propanamide |
| SMILES | COc1cc2c(cc1NC(=O)CCn1[nH]c(=O)ccc1=O)oc1ccccc12 |
| InChI | InChI=1S/C20H17N3O5/c1-27-17-10-13-12-4-2-3-5-15(12)28-16(13)11-14(17)21-18(24)8-9-23-20(26)7-6-19(25)22-23/h2-7,10-11H,8-9H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | UCKQPGYFGITDDS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |