C24H20N2O3 — CID 3972625
3-(1H-indol-3-yl)-N-(2-methoxydibenzofuran-3-yl)propanamide (PubChem CID 3972625) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-N-(2-methoxydibenzofuran-3-yl)propanamide.
| Compound Name | 3-(1H-indol-3-yl)-N-(2-methoxydibenzofuran-3-yl)propanamide |
|---|---|
| PubChem CID | 3972625 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 3-(1H-indol-3-yl)-N-(2-methoxydibenzofuran-3-yl)propanamide |
| SMILES | COc1cc2c(cc1NC(=O)CCc1c[nH]c3ccccc13)oc1ccccc12 |
| InChI | InChI=1S/C24H20N2O3/c1-28-23-12-18-17-7-3-5-9-21(17)29-22(18)13-20(23)26-24(27)11-10-15-14-25-19-8-4-2-6-16(15)19/h2-9,12-14,25H,10-11H2,1H3,(H,26,27) |
| InChIKey | QAVBANVBDZMLBX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |