C27H22N4O5 — CID 3933614
2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxydibenzofuran-3-yl)acetamide (PubChem CID 3933614) has the molecular formula C27H22N4O5 and a molecular weight of 482.50 g/mol. Its IUPAC name is 2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxydibenzofuran-3-yl)acetamide.
| Compound Name | 2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxydibenzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 3933614 |
| Molecular Formula | C27H22N4O5 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxydibenzofuran-3-yl)acetamide |
| SMILES | COc1cc2c(cc1NC(=O)CN1C(=O)NC(Cc3c[nH]c4ccccc34)C1=O)oc1ccccc12 |
| InChI | InChI=1S/C27H22N4O5/c1-35-24-11-18-17-7-3-5-9-22(17)36-23(18)12-20(24)29-25(32)14-31-26(33)21(30-27(31)34)10-15-13-28-19-8-4-2-6-16(15)19/h2-9,11-13,21,28H,10,14H2,1H3,(H,29,32)(H,30,34) |
| InChIKey | UVDJCMKKFZWLPW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|