C24H26N4O5 — CID 42927220
N-(2,5-diethoxyphenyl)-2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 42927220) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2,5-diethoxyphenyl)-2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 42927220 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)CN2C(=O)NC(Cc3c[nH]c4ccccc34)C2=O)c1 |
| InChI | InChI=1S/C24H26N4O5/c1-3-32-16-9-10-21(33-4-2)19(12-16)26-22(29)14-28-23(30)20(27-24(28)31)11-15-13-25-18-8-6-5-7-17(15)18/h5-10,12-13,20,25H,3-4,11,14H2,1-2H3,(H,26,29)(H,27,31) |
| InChIKey | MIHORAZSXZROSS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|