C20H17FN4O3 — CID 51864114
N-(3-fluorophenyl)-2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 51864114) has the molecular formula C20H17FN4O3 and a molecular weight of 380.38 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 51864114 |
| Molecular Formula | C20H17FN4O3 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-(3-fluorophenyl)-2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | O=C(CN1C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C1=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C20H17FN4O3/c21-13-4-3-5-14(9-13)23-18(26)11-25-19(27)17(24-20(25)28)8-12-10-22-16-7-2-1-6-15(12)16/h1-7,9-10,17,22H,8,11H2,(H,23,26)(H,24,28)/t17-/m0/s1 |
| InChIKey | WNHXQLZKDLEMSB-KRWDZBQOSA-N |
| XLogP | 2.41 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|