C25H27N5O5S — CID 26888667
2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-(3-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 26888667) has the molecular formula C25H27N5O5S and a molecular weight of 509.59 g/mol. Its IUPAC name is 2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-(3-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 26888667 |
| Molecular Formula | C25H27N5O5S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C1=O)Nc1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C25H27N5O5S/c31-23(27-18-7-6-8-19(14-18)36(34,35)29-11-4-1-5-12-29)16-30-24(32)22(28-25(30)33)13-17-15-26-21-10-3-2-9-20(17)21/h2-3,6-10,14-15,22,26H,1,4-5,11-13,16H2,(H,27,31)(H,28,33)/t22-/m0/s1 |
| InChIKey | HIVJMOXQTKVCBX-QFIPXVFZSA-N |
| XLogP | 2.44 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|