C26H31N3O5S — CID 4874930
[2-[3-(azepan-1-ylsulfonyl)anilino]-2-oxoethyl] 4-(1H-indol-3-yl)butanoate (PubChem CID 4874930) has the molecular formula C26H31N3O5S and a molecular weight of 497.62 g/mol. Its IUPAC name is [2-[3-(azepan-1-ylsulfonyl)anilino]-2-oxoethyl] 4-(1H-indol-3-yl)butanoate.
| Compound Name | [2-[3-(azepan-1-ylsulfonyl)anilino]-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 4874930 |
| Molecular Formula | C26H31N3O5S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | [2-[3-(azepan-1-ylsulfonyl)anilino]-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
| SMILES | O=C(COC(=O)CCCc1c[nH]c2ccccc12)Nc1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C26H31N3O5S/c30-25(19-34-26(31)14-7-9-20-18-27-24-13-4-3-12-23(20)24)28-21-10-8-11-22(17-21)35(32,33)29-15-5-1-2-6-16-29/h3-4,8,10-13,17-18,27H,1-2,5-7,9,14-16,19H2,(H,28,30) |
| InChIKey | IDXOZPVDGTYFGG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |