C20H28N2O5S — CID 35776383
[2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl] 2-cyclohexylacetate (PubChem CID 35776383) has the molecular formula C20H28N2O5S and a molecular weight of 408.52 g/mol. Its IUPAC name is [2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl] 2-cyclohexylacetate.
| Compound Name | [2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl] 2-cyclohexylacetate |
|---|---|
| PubChem CID | 35776383 |
| Molecular Formula | C20H28N2O5S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl] 2-cyclohexylacetate |
| SMILES | O=C(COC(=O)CC1CCCCC1)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C20H28N2O5S/c23-19(15-27-20(24)13-16-7-2-1-3-8-16)21-17-9-6-10-18(14-17)28(25,26)22-11-4-5-12-22/h6,9-10,14,16H,1-5,7-8,11-13,15H2,(H,21,23) |
| InChIKey | IXDOOSQHLWIVMR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |