C17H22N2O4 — CID 7722315
[2-(3-acetamidoanilino)-2-oxoethyl] 2-cyclopentylacetate (PubChem CID 7722315) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is [2-(3-acetamidoanilino)-2-oxoethyl] 2-cyclopentylacetate.
| Compound Name | [2-(3-acetamidoanilino)-2-oxoethyl] 2-cyclopentylacetate |
|---|---|
| PubChem CID | 7722315 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | [2-(3-acetamidoanilino)-2-oxoethyl] 2-cyclopentylacetate |
| SMILES | CC(=O)Nc1cccc(NC(=O)COC(=O)CC2CCCC2)c1 |
| InChI | InChI=1S/C17H22N2O4/c1-12(20)18-14-7-4-8-15(10-14)19-16(21)11-23-17(22)9-13-5-2-3-6-13/h4,7-8,10,13H,2-3,5-6,9,11H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | WXCOXZWFJIWNLM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |