C16H20ClNO3 — CID 2386731
[2-(3-chloroanilino)-2-oxoethyl] 3-cyclopentylpropanoate (PubChem CID 2386731) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] 3-cyclopentylpropanoate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 2386731 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] 3-cyclopentylpropanoate |
| SMILES | O=C(COC(=O)CCC1CCCC1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H20ClNO3/c17-13-6-3-7-14(10-13)18-15(19)11-21-16(20)9-8-12-4-1-2-5-12/h3,6-7,10,12H,1-2,4-5,8-9,11H2,(H,18,19) |
| InChIKey | WKAMUVKTSQZGNW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |