C17H22FNO3 — CID 2435257
[2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-cyclopentylpropanoate (PubChem CID 2435257) has the molecular formula C17H22FNO3 and a molecular weight of 307.36 g/mol. Its IUPAC name is [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-cyclopentylpropanoate.
| Compound Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 2435257 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-cyclopentylpropanoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)CCC2CCCC2)cc1F |
| InChI | InChI=1S/C17H22FNO3/c1-12-6-8-14(10-15(12)18)19-16(20)11-22-17(21)9-7-13-4-2-3-5-13/h6,8,10,13H,2-5,7,9,11H2,1H3,(H,19,20) |
| InChIKey | JUYMTNXWVYIPFC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |