C20H23NO3 — CID 7751597
[2-(naphthalen-2-ylamino)-2-oxoethyl] 3-cyclopentylpropanoate (PubChem CID 7751597) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is [2-(naphthalen-2-ylamino)-2-oxoethyl] 3-cyclopentylpropanoate.
| Compound Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 7751597 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 3-cyclopentylpropanoate |
| SMILES | O=C(COC(=O)CCC1CCCC1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H23NO3/c22-19(14-24-20(23)12-9-15-5-1-2-6-15)21-18-11-10-16-7-3-4-8-17(16)13-18/h3-4,7-8,10-11,13,15H,1-2,5-6,9,12,14H2,(H,21,22) |
| InChIKey | UBFACLUJTSPQMT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |