C24H27NO3 — CID 7695749
[2-(naphthalen-2-ylamino)-2-oxoethyl] 2-(1-adamantyl)acetate (PubChem CID 7695749) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-(1-adamantyl)acetate.
| Compound Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-(1-adamantyl)acetate |
|---|---|
| PubChem CID | 7695749 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-(1-adamantyl)acetate |
| SMILES | O=C(COC(=O)CC12CC3CC(CC(C3)C1)C2)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H27NO3/c26-22(25-21-6-5-19-3-1-2-4-20(19)10-21)15-28-23(27)14-24-11-16-7-17(12-24)9-18(8-16)13-24/h1-6,10,16-18H,7-9,11-15H2,(H,25,26) |
| InChIKey | LKPBUNCNBDLHIK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |