C21H27NO4 — CID 9126908
[2-(4-methylanilino)-2-oxoethyl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate (PubChem CID 9126908) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate |
|---|---|
| PubChem CID | 9126908 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)CC23C[C@@H]4C[C@@H](CC(O)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C21H27NO4/c1-14-2-4-17(5-3-14)22-18(23)12-26-19(24)11-20-7-15-6-16(8-20)10-21(25,9-15)13-20/h2-5,15-16,25H,6-13H2,1H3,(H,22,23)/t15-,16+,20?,21? |
| InChIKey | VXQOWCWKPCKYTC-XBLGPDGASA-N |
| XLogP | 3.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |