C20H24O4 — CID 9127158
phenacyl 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate (PubChem CID 9127158) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is phenacyl 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate.
| Compound Name | phenacyl 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate |
|---|---|
| PubChem CID | 9127158 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | phenacyl 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate |
| SMILES | O=C(CC12C[C@@H]3C[C@@H](CC(O)(C3)C1)C2)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H24O4/c21-17(16-4-2-1-3-5-16)12-24-18(22)11-19-7-14-6-15(8-19)10-20(23,9-14)13-19/h1-5,14-15,23H,6-13H2/t14-,15+,19?,20? |
| InChIKey | ZAFPEQWTQJDNBU-JNKARSBBSA-N |
| XLogP | 3.13 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |