C20H23BrO3 — CID 98292289
phenacyl 2-[(5R,7R)-3-bromo-1-adamantyl]acetate (PubChem CID 98292289) has the molecular formula C20H23BrO3 and a molecular weight of 391.31 g/mol. Its IUPAC name is phenacyl 2-[(5R,7R)-3-bromo-1-adamantyl]acetate.
| Compound Name | phenacyl 2-[(5R,7R)-3-bromo-1-adamantyl]acetate |
|---|---|
| PubChem CID | 98292289 |
| Molecular Formula | C20H23BrO3 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | phenacyl 2-[(5R,7R)-3-bromo-1-adamantyl]acetate |
| SMILES | O=C(CC12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23BrO3/c21-20-9-14-6-15(10-20)8-19(7-14,13-20)11-18(23)24-12-17(22)16-4-2-1-3-5-16/h1-5,14-15H,6-13H2/t14-,15-,19?,20?/m1/s1 |
| InChIKey | AZUVAXGGAGDYQZ-SNEKZUEESA-N |
| XLogP | 4.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|