C23H30BrNO4 — CID 55318315
[2-[(4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 2-(3-bromo-1-adamantyl)acetate (PubChem CID 55318315) has the molecular formula C23H30BrNO4 and a molecular weight of 464.40 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 2-(3-bromo-1-adamantyl)acetate.
| Compound Name | [2-[(4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 2-(3-bromo-1-adamantyl)acetate |
|---|---|
| PubChem CID | 55318315 |
| Molecular Formula | C23H30BrNO4 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | [2-[(4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 2-(3-bromo-1-adamantyl)acetate |
| SMILES | COc1ccc(CN(C)C(=O)COC(=O)CC23CC4CC(CC(Br)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H30BrNO4/c1-25(13-16-3-5-19(28-2)6-4-16)20(26)14-29-21(27)12-22-8-17-7-18(9-22)11-23(24,10-17)15-22/h3-6,17-18H,7-15H2,1-2H3 |
| InChIKey | IAFVLZOTIWPKRV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|