C21H25Br2NO3 — CID 55315981
[2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] 3-bromoadamantane-1-carboxylate (PubChem CID 55315981) has the molecular formula C21H25Br2NO3 and a molecular weight of 499.24 g/mol. Its IUPAC name is [2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] 3-bromoadamantane-1-carboxylate.
| Compound Name | [2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] 3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 55315981 |
| Molecular Formula | C21H25Br2NO3 |
| Molecular Weight | 499.24 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | [2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] 3-bromoadamantane-1-carboxylate |
| SMILES | CN(Cc1ccccc1Br)C(=O)COC(=O)C12CC3CC(CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C21H25Br2NO3/c1-24(11-16-4-2-3-5-17(16)22)18(25)12-27-19(26)20-7-14-6-15(8-20)10-21(23,9-14)13-20/h2-5,14-15H,6-13H2,1H3 |
| InChIKey | IDGYMWLTNNIXMY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.24 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|