C17H16BrNO3 — CID 55319343
[2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] benzoate (PubChem CID 55319343) has the molecular formula C17H16BrNO3 and a molecular weight of 362.22 g/mol. Its IUPAC name is [2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] benzoate.
| Compound Name | [2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] benzoate |
|---|---|
| PubChem CID | 55319343 |
| Molecular Formula | C17H16BrNO3 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | [2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] benzoate |
| SMILES | CN(Cc1ccccc1Br)C(=O)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16BrNO3/c1-19(11-14-9-5-6-10-15(14)18)16(20)12-22-17(21)13-7-3-2-4-8-13/h2-10H,11-12H2,1H3 |
| InChIKey | JVJZEJPOOROTJT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |