C18H16BrN3O3 — CID 16525603
[2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] 1H-indazole-3-carboxylate (PubChem CID 16525603) has the molecular formula C18H16BrN3O3 and a molecular weight of 402.25 g/mol. Its IUPAC name is [2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] 1H-indazole-3-carboxylate.
| Compound Name | [2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] 1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 16525603 |
| Molecular Formula | C18H16BrN3O3 |
| Molecular Weight | 402.25 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | [2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] 1H-indazole-3-carboxylate |
| SMILES | CN(Cc1ccccc1Br)C(=O)COC(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C18H16BrN3O3/c1-22(10-12-6-2-4-8-14(12)19)16(23)11-25-18(24)17-13-7-3-5-9-15(13)20-21-17/h2-9H,10-11H2,1H3,(H,20,21) |
| InChIKey | RJCASXHHLCBDEW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |