C21H21BrN2O3 — CID 55304114
[2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate (PubChem CID 55304114) has the molecular formula C21H21BrN2O3 and a molecular weight of 429.31 g/mol. Its IUPAC name is [2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate.
| Compound Name | [2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 55304114 |
| Molecular Formula | C21H21BrN2O3 |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | [2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate |
| SMILES | CN(Cc1ccccc1Br)C(=O)COC(=O)CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H21BrN2O3/c1-24(13-16-6-2-4-8-18(16)22)20(25)14-27-21(26)11-10-15-12-23-19-9-5-3-7-17(15)19/h2-9,12,23H,10-11,13-14H2,1H3 |
| InChIKey | IJDPGMRBSGJOON-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |