C15H16N4O3 — CID 9288144
[2-[2-cyanopropan-2-yl(methyl)amino]-2-oxoethyl] 1H-indazole-3-carboxylate (PubChem CID 9288144) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is [2-[2-cyanopropan-2-yl(methyl)amino]-2-oxoethyl] 1H-indazole-3-carboxylate.
| Compound Name | [2-[2-cyanopropan-2-yl(methyl)amino]-2-oxoethyl] 1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 9288144 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | [2-[2-cyanopropan-2-yl(methyl)amino]-2-oxoethyl] 1H-indazole-3-carboxylate |
| SMILES | CN(C(=O)COC(=O)c1n[nH]c2ccccc12)C(C)(C)C#N |
| InChI | InChI=1S/C15H16N4O3/c1-15(2,9-16)19(3)12(20)8-22-14(21)13-10-6-4-5-7-11(10)17-18-13/h4-7H,8H2,1-3H3,(H,17,18) |
| InChIKey | ADZYMPDMUARNFF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |