C14H12N4O3 — CID 7927625
(3-cyano-4-imino-2-oxopentyl) 1H-indazole-3-carboxylate (PubChem CID 7927625) has the molecular formula C14H12N4O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 1H-indazole-3-carboxylate.
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 7927625 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 1H-indazole-3-carboxylate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C14H12N4O3/c1-8(16)10(6-15)12(19)7-21-14(20)13-9-4-2-3-5-11(9)17-18-13/h2-5,10,16H,7H2,1H3,(H,17,18)/b16-8+ |
| InChIKey | JSKMHCPXYFHBMX-LZYBPNLTSA-N |
| XLogP | 1.47 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|