C14H17N3O3 — CID 2534563
[2-(tert-butylamino)-2-oxoethyl] 1H-indazole-3-carboxylate (PubChem CID 2534563) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 1H-indazole-3-carboxylate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 2534563 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 1H-indazole-3-carboxylate |
| SMILES | CC(C)(C)NC(=O)COC(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C14H17N3O3/c1-14(2,3)15-11(18)8-20-13(19)12-9-6-4-5-7-10(9)16-17-12/h4-7H,8H2,1-3H3,(H,15,18)(H,16,17) |
| InChIKey | QWWDQGHHSKSJSN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |