C16H10Cl3N3O3 — CID 4676467
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] 1H-indazole-3-carboxylate (PubChem CID 4676467) has the molecular formula C16H10Cl3N3O3 and a molecular weight of 398.63 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 1H-indazole-3-carboxylate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 4676467 |
| Molecular Formula | C16H10Cl3N3O3 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 1H-indazole-3-carboxylate |
| SMILES | O=C(COC(=O)c1n[nH]c2ccccc12)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H10Cl3N3O3/c17-9-5-11(19)13(6-10(9)18)20-14(23)7-25-16(24)15-8-3-1-2-4-12(8)21-22-15/h1-6H,7H2,(H,20,23)(H,21,22) |
| InChIKey | DMZKBPUELCSRJL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|