C16H11ClN4O5 — CID 2541117
[2-(2-chloro-5-nitroanilino)-2-oxoethyl] 1H-indazole-3-carboxylate (PubChem CID 2541117) has the molecular formula C16H11ClN4O5 and a molecular weight of 374.74 g/mol. Its IUPAC name is [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 1H-indazole-3-carboxylate.
| Compound Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 2541117 |
| Molecular Formula | C16H11ClN4O5 |
| Molecular Weight | 374.74 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 1H-indazole-3-carboxylate |
| SMILES | O=C(COC(=O)c1n[nH]c2ccccc12)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C16H11ClN4O5/c17-11-6-5-9(21(24)25)7-13(11)18-14(22)8-26-16(23)15-10-3-1-2-4-12(10)19-20-15/h1-7H,8H2,(H,18,22)(H,19,20) |
| InChIKey | CGDDVPZJXXBKGA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.74 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|