C17H14ClN3O3 — CID 2540932
[2-(2-chloro-4-methylanilino)-2-oxoethyl] 1H-indazole-3-carboxylate (PubChem CID 2540932) has the molecular formula C17H14ClN3O3 and a molecular weight of 343.77 g/mol. Its IUPAC name is [2-(2-chloro-4-methylanilino)-2-oxoethyl] 1H-indazole-3-carboxylate.
| Compound Name | [2-(2-chloro-4-methylanilino)-2-oxoethyl] 1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 2540932 |
| Molecular Formula | C17H14ClN3O3 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | [2-(2-chloro-4-methylanilino)-2-oxoethyl] 1H-indazole-3-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2n[nH]c3ccccc23)c(Cl)c1 |
| InChI | InChI=1S/C17H14ClN3O3/c1-10-6-7-14(12(18)8-10)19-15(22)9-24-17(23)16-11-4-2-3-5-13(11)20-21-16/h2-8H,9H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | BBIMSYVJGRHYGH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |