C20H15N3O3 — CID 2478469
[2-(naphthalen-1-ylamino)-2-oxoethyl] 1H-indazole-3-carboxylate (PubChem CID 2478469) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] 1H-indazole-3-carboxylate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 2478469 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 1H-indazole-3-carboxylate |
| SMILES | O=C(COC(=O)c1n[nH]c2ccccc12)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C20H15N3O3/c24-18(21-16-11-5-7-13-6-1-2-8-14(13)16)12-26-20(25)19-15-9-3-4-10-17(15)22-23-19/h1-11H,12H2,(H,21,24)(H,22,23) |
| InChIKey | BVEZOKRQCJFOGM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |