C20H20N4O4 — CID 99434673
[2-(2-methylanilino)-2-oxoethyl] 3-(1H-indazole-3-carbonylamino)propanoate (PubChem CID 99434673) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is [2-(2-methylanilino)-2-oxoethyl] 3-(1H-indazole-3-carbonylamino)propanoate.
| Compound Name | [2-(2-methylanilino)-2-oxoethyl] 3-(1H-indazole-3-carbonylamino)propanoate |
|---|---|
| PubChem CID | 99434673 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | [2-(2-methylanilino)-2-oxoethyl] 3-(1H-indazole-3-carbonylamino)propanoate |
| SMILES | Cc1ccccc1NC(=O)COC(=O)CCNC(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C20H20N4O4/c1-13-6-2-4-8-15(13)22-17(25)12-28-18(26)10-11-21-20(27)19-14-7-3-5-9-16(14)23-24-19/h2-9H,10-12H2,1H3,(H,21,27)(H,22,25)(H,23,24) |
| InChIKey | UUOAJUNMFVZOGJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |