C11H10N4O4 — CID 2626910
[2-(carbamoylamino)-2-oxoethyl] 1H-indazole-3-carboxylate (PubChem CID 2626910) has the molecular formula C11H10N4O4 and a molecular weight of 262.23 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 1H-indazole-3-carboxylate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 2626910 |
| Molecular Formula | C11H10N4O4 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 1H-indazole-3-carboxylate |
| SMILES | NC(=O)NC(=O)COC(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C11H10N4O4/c12-11(18)13-8(16)5-19-10(17)9-6-3-1-2-4-7(6)14-15-9/h1-4H,5H2,(H,14,15)(H3,12,13,16,18) |
| InChIKey | QIKSBLARRCIVSP-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |