C16H20N4O4 — CID 2534586
[2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 1H-indazole-3-carboxylate (PubChem CID 2534586) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 1H-indazole-3-carboxylate.
| Compound Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 2534586 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 1H-indazole-3-carboxylate |
| SMILES | CC(C)CCNC(=O)NC(=O)COC(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C16H20N4O4/c1-10(2)7-8-17-16(23)18-13(21)9-24-15(22)14-11-5-3-4-6-12(11)19-20-14/h3-6,10H,7-9H2,1-2H3,(H,19,20)(H2,17,18,21,23) |
| InChIKey | ZMTRIDNMYAAKIF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |