C20H21N3O3 — CID 2479149
[2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 1H-indazole-3-carboxylate (PubChem CID 2479149) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is [2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 1H-indazole-3-carboxylate.
| Compound Name | [2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 2479149 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | [2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 1H-indazole-3-carboxylate |
| SMILES | CC[C@@H](C)c1ccc(NC(=O)COC(=O)c2n[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C20H21N3O3/c1-3-13(2)14-8-10-15(11-9-14)21-18(24)12-26-20(25)19-16-6-4-5-7-17(16)22-23-19/h4-11,13H,3,12H2,1-2H3,(H,21,24)(H,22,23)/t13-/m1/s1 |
| InChIKey | HPMHDUFKMBWNJU-CYBMUJFWSA-N |
| XLogP | 3.87 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |