C23H23NO3 — CID 7785327
[2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] naphthalene-1-carboxylate (PubChem CID 7785327) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is [2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] naphthalene-1-carboxylate.
| Compound Name | [2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 7785327 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | [2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] naphthalene-1-carboxylate |
| SMILES | CC[C@H](C)c1ccc(NC(=O)COC(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C23H23NO3/c1-3-16(2)17-11-13-19(14-12-17)24-22(25)15-27-23(26)21-10-6-8-18-7-4-5-9-20(18)21/h4-14,16H,3,15H2,1-2H3,(H,24,25)/t16-/m0/s1 |
| InChIKey | SNGAAQNWCPLVTC-INIZCTEOSA-N |
| XLogP | 5.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |