C26H27NO3 — CID 3616999
[2-(4-butan-2-ylanilino)-2-oxoethyl] 2-(4-methylphenyl)benzoate (PubChem CID 3616999) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is [2-(4-butan-2-ylanilino)-2-oxoethyl] 2-(4-methylphenyl)benzoate.
| Compound Name | [2-(4-butan-2-ylanilino)-2-oxoethyl] 2-(4-methylphenyl)benzoate |
|---|---|
| PubChem CID | 3616999 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | [2-(4-butan-2-ylanilino)-2-oxoethyl] 2-(4-methylphenyl)benzoate |
| SMILES | CCC(C)c1ccc(NC(=O)COC(=O)c2ccccc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H27NO3/c1-4-19(3)20-13-15-22(16-14-20)27-25(28)17-30-26(29)24-8-6-5-7-23(24)21-11-9-18(2)10-12-21/h5-16,19H,4,17H2,1-3H3,(H,27,28) |
| InChIKey | CQEXTROCRFBUHM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |