C21H25NO5 — CID 2503716
[2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 2,3-dimethoxybenzoate (PubChem CID 2503716) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is [2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 2,3-dimethoxybenzoate.
| Compound Name | [2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 2503716 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 2,3-dimethoxybenzoate |
| SMILES | CC[C@H](C)c1ccc(NC(=O)COC(=O)c2cccc(OC)c2OC)cc1 |
| InChI | InChI=1S/C21H25NO5/c1-5-14(2)15-9-11-16(12-10-15)22-19(23)13-27-21(24)17-7-6-8-18(25-3)20(17)26-4/h6-12,14H,5,13H2,1-4H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | MHMZDWUYGBCNRB-AWEZNQCLSA-N |
| XLogP | 4.01 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |